Traduzca Met para Español

Babylon 10

El software de traducción más popular

Descárguelo, es gratuito

Lengua Fonte

Lengua de Destino



encontrar; responsabilizarse por; encontrarse, reunirse, tener tertulia; tener una reunión


v.- confluir | converger | convergir | desembocar | centrarse | intersectarse | encontrarse | reunirse | reunir | conocer | atender (necesidades, exigencias, etc) | cubrir | cumplir | ajustarse a | alcanzar s.- confluencia | convergencia | empalme | cruce | enfrentamiento

s. Metionina. Aminioácido con la siguiente fórmula
CH3-S-(CH2)2-CH(NH2)-COOH

(v.) = Tiempo pasado y participio del verbo meet (reunirse).

Def: Véase éste y sus derivados para los distintos significados.
Ex: I do not believe that the need of any are being adequately met.
(v.) = reunirse.

Def: Verbo irregular: pasado y participio met.
Ex: Many committees do not meet more than once a year, and all work on the committees is voluntary.
----
* meet + set of conditions = reunir una serie de condiciones.
* meet up (with) = encontrarse (con), reunirse (con), verse (con).
(v.) = encontrarse con.
Ex: Stopping a few miles north of where the Lewark meets the great Modoc River in what is now called the American midwest, they constructed a humble cabin and began trading with river men and friendly Indians.
----
* make + (both) ends meet = llegar a final de mes, salir a flote, salir adelante.
* meet + a friend = encontrarse con un amigo.
* meet + Alguien = conocer a Alguien.
* meet + deaf ears = caer en oídos sordos, hacer caso omiso.
* meet + face to face = conocer personalmente.
* meet + in person = conocer personalmente.
* meet + Posesivo + death = encontrar la muerte, fallecer, morir.
* meet + Posesivo + demise = encontrar la muerte, fallecer, morir.
* meet + Posesivo + destiny = encontrar + Posesivo + destino, reunirse con + Posesivo + destino, encontrar + Posesivo + destino, reunirse con + Posesivo + destino, encontrar la muerte, fallecer, morir.
* meet + Posesivo + fate = encontrar + Posesivo + destino, encontrar la muerte, fallecer, morir.
* meet + Posesivo + match = encontrar la horma de + Posesivo + zapato.
* meet with = toparse con.
* meet with + approval = obtener la aprobación, recibir el visto bueno, contar con la aprobación, contar con el visto bueno.
* meet with + a problem = encontrarse con un problema, toparse con un problema.
* meet with + failure = fracasar.
* meet with + opposition = encontrar oposición.
* meet with + success = tener éxito.
* more than meets the eye = más complejo de lo que parece, más complicado de lo que parece.
* there's more to it than meets the eye = las cosas no son tan simples como parecen, las cosas son más complicadas de lo que parecen, aquí hay gato encerrado, las apariencias engañan.
* there's more to the picture than meets the eye = las cosas no son tan simples como parecen, las cosas son más complicadas de lo que parecen, aquí hay gato encerrado, las apariencias engañan.
(v.) = tratar, abordar, cubrir, hacer frente a, enfrentarse a, atender, satisfacer.

Def: Verbo irregular: pasado y participio met.
Ex: There may be a threat of over-capacity; if so, this could be met by diversification, an enlargement of the SLIS role.
----
* meet + challenge = enfrentarse a un reto, hacer frente a un reto.
* meet + change = hacer frente a un cambio.
* meet + condition = cumplir una condición.
* meet + cost = hacer frente a un gasto, sufragar un gasto.
* meet + crisis = hacer frente a una crisis.
* meet + criterion = cumplir un requisito.
* meet + deadline = cumplir (con) un plazo.
* meet + debts = hacer frente a deudas, pagar deudas.
* meet + demand = satisfacer una demanda.
* meet + development = adaptarse a una innovación.
* meet + expectation = satisfacer una expectativa.
* meet + expenses = hacer frente a gastos, sufragar gastos.
* meet + format = adaptarse a un formato.
* meet + Nombre + halfway = llegar a una solución intermedia, llegar a un compromiso.
* meet + Nombre + head-on = hacer frente, tratar Algo sin rodeos, enfrentarse a Algo cara a cara, encarar, plantar cara a.
* meet + objective = cumplir un objetivo, cubrir un objetivo.
* meet + Posesivo + approval = obtener + Posesivo + aprobación, recibir + Posesivo + visto bueno, contar con + Posesivo + aprobación, contar con + Posesivo + visto bueno.
* meet + Posesivo + goal = alcanzar una meta.
* meet + Posesivo + needs = hacer frente a una necesidad, satisfacer una necesidad, atender a una necesidad, cubrir una necesidad.
* meet + price = pagar el precio.
* meet + purpose = cubrir un objetivo, cumplir un objetivo.
* meet + quota = completar un cupo.
* meet + request = satisfacer una petición.
* meet + requirement = satisfacer una necesidad.
* meet + responsibility = hacer frente a una responsabilidad.
* meet + situation = enfrentarse a una situación.
* meet + specification = cumplir un requisito.
* meet + standard = cumplir (con) un criterio.
* meet + success = tener éxito.
* meet + target = cumplir un objetivo.
* meet + uncertainty = hacer frente a una incertidumbre.
* meet with + Adjetivo + reaction = enfrentarse a una reacción + Adjetivo, recibirse con una reacción + Adjetivo.
* rise to + meet = superarse para hacer frente a Algo.
* tailor to + meet the specification = hacer a medida para satisfacer los requisitos.



Translate the Inglés term Met to other languages